* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1065607 |
English Synonyms: | FCHGROUP FCH1065607 |
MDL Number.: | MFCD16781322 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCn1cc(cn1)CC(C)CN |
InChi: | InChI=1S/C9H17N3/c1-3-12-7-9(6-11-12)4-8(2)5-10/h6-8H,3-5,10H2,1-2H3 |
InChiKey: | InChIKey=YXNMFHKHLYFTFA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.