* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(AMINOMETHYL)-2-METHYLDECANE |
| English Synonyms: | 3-(AMINOMETHYL)-2-METHYLDECANE |
| MDL Number.: | MFCD16781484 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCCCC(CN)C(C)C |
| InChi: | InChI=1S/C12H27N/c1-4-5-6-7-8-9-12(10-13)11(2)3/h11-12H,4-10,13H2,1-3H3 |
| InChiKey: | InChIKey=IOFMKCBEHBEZSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.