* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(AMINOMETHYL)DECANE |
| English Synonyms: | 3-(AMINOMETHYL)DECANE |
| MDL Number.: | MFCD16781540 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCCCC(CC)CN |
| InChi: | InChI=1S/C11H25N/c1-3-5-6-7-8-9-11(4-2)10-12/h11H,3-10,12H2,1-2H3 |
| InChiKey: | InChIKey=VUXZTDCGPBRNIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.