* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34318721 |
English Synonyms: | UKRORGSYN-BB BBV-34318721 |
MDL Number.: | MFCD16782415 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCNCC(Cc1ccsc1)CC(C)C |
InChi: | InChI=1S/C13H23NS/c1-4-14-9-13(7-11(2)3)8-12-5-6-15-10-12/h5-6,10-11,13-14H,4,7-9H2,1-3H3 |
InChiKey: | InChIKey=ZWDOPXDRDVAREJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.