* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34318735 |
English Synonyms: | UKRORGSYN-BB BBV-34318735 |
MDL Number.: | MFCD16782429 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCNCC(Cc1cccs1)CC(C)C |
InChi: | InChI=1S/C14H25NS/c1-4-7-15-11-13(9-12(2)3)10-14-6-5-8-16-14/h5-6,8,12-13,15H,4,7,9-11H2,1-3H3 |
InChiKey: | InChIKey=HFRJCTJGTRJYNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.