* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34318751 |
English Synonyms: | UKRORGSYN-BB BBV-34318751 |
MDL Number.: | MFCD16782444 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)CC(Cc1ccsc1)CNC(C)C |
InChi: | InChI=1S/C14H25NS/c1-11(2)7-14(9-15-12(3)4)8-13-5-6-16-10-13/h5-6,10-12,14-15H,7-9H2,1-4H3 |
InChiKey: | InChIKey=HZTUNJBUUCYEFH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.