* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34318795 |
English Synonyms: | UKRORGSYN-BB BBV-34318795 |
MDL Number.: | MFCD16782484 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCC(Cc1cccs1)CNC |
InChi: | InChI=1S/C11H19NS/c1-3-5-10(9-12-2)8-11-6-4-7-13-11/h4,6-7,10,12H,3,5,8-9H2,1-2H3 |
InChiKey: | InChIKey=LQZBDGMAFNFRON-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.