* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34318799 |
English Synonyms: | UKRORGSYN-BB BBV-34318799 |
MDL Number.: | MFCD16782488 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCC(Cc1ccc(s1)CC)CNC |
InChi: | InChI=1S/C13H23NS/c1-4-6-11(10-14-3)9-13-8-7-12(5-2)15-13/h7-8,11,14H,4-6,9-10H2,1-3H3 |
InChiKey: | InChIKey=QSEKTVYJORZQME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.