* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320717 |
English Synonyms: | UKRORGSYN-BB BBV-34320717 |
MDL Number.: | MFCD16784286 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1ccc(o1)CNC(=O)C(C)(C)C(=S)N |
InChi: | InChI=1S/C11H16N2O2S/c1-7-4-5-8(15-7)6-13-10(14)11(2,3)9(12)16/h4-5H,6H2,1-3H3,(H2,12,16)(H,13,14) |
InChiKey: | InChIKey=SZZXLHQMFAVVQW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.