* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320733 |
English Synonyms: | UKRORGSYN-BB BBV-34320733 |
MDL Number.: | MFCD16784302 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ccc(o1)Cn2ccnc2S |
InChi: | InChI=1S/C9H10N2OS/c1-7-2-3-8(12-7)6-11-5-4-10-9(11)13/h2-5H,6H2,1H3,(H,10,13) |
InChiKey: | InChIKey=WVLPVTRGQSYUOV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.