* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320748 |
English Synonyms: | UKRORGSYN-BB BBV-34320748 |
MDL Number.: | MFCD16784317 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | Cc1ccc(o1)CNC(=N)NCC(C)C |
InChi: | InChI=1S/C11H19N3O/c1-8(2)6-13-11(12)14-7-10-5-4-9(3)15-10/h4-5,8H,6-7H2,1-3H3,(H3,12,13,14) |
InChiKey: | InChIKey=LMKYPFTYPMSXBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.