* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320761 |
English Synonyms: | UKRORGSYN-BB BBV-34320761 |
MDL Number.: | MFCD16784330 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCNCCNCc1ccc(o1)C |
InChi: | InChI=1S/C11H20N2O/c1-3-6-12-7-8-13-9-11-5-4-10(2)14-11/h4-5,12-13H,3,6-9H2,1-2H3 |
InChiKey: | InChIKey=ARZRAFARKFIEPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.