* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320764 |
English Synonyms: | UKRORGSYN-BB BBV-34320764 |
MDL Number.: | MFCD16784333 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(o1)CNCC2CCCCN2 |
InChi: | InChI=1S/C12H20N2O/c1-10-5-6-12(15-10)9-13-8-11-4-2-3-7-14-11/h5-6,11,13-14H,2-4,7-9H2,1H3 |
InChiKey: | InChIKey=AVOSMLOIEICCBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.