* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320776 |
English Synonyms: | UKRORGSYN-BB BBV-34320776 |
MDL Number.: | MFCD16784345 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCC(CNCc1ccc(o1)C)N |
InChi: | InChI=1S/C11H20N2O/c1-3-4-10(12)7-13-8-11-6-5-9(2)14-11/h5-6,10,13H,3-4,7-8,12H2,1-2H3 |
InChiKey: | InChIKey=MYVPWONILCNPKZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.