* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34320789 |
English Synonyms: | UKRORGSYN-BB BBV-34320789 |
MDL Number.: | MFCD16784358 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(o1)CNCC(C)(C2CC2)N |
InChi: | InChI=1S/C12H20N2O/c1-9-3-6-11(15-9)7-14-8-12(2,13)10-4-5-10/h3,6,10,14H,4-5,7-8,13H2,1-2H3 |
InChiKey: | InChIKey=YIPQJIWPLQQFHI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.