* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8,8-DIMETHYL-9-OXA-6-AZASPIRO[4.5]DECANE |
English Synonyms: | 8,8-DIMETHYL-9-OXA-6-AZASPIRO[4.5]DECANE |
MDL Number.: | MFCD16784858 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CC1(CNC2(CCCC2)CO1)C |
InChi: | InChI=1S/C10H19NO/c1-9(2)7-11-10(8-12-9)5-3-4-6-10/h11H,3-8H2,1-2H3 |
InChiKey: | InChIKey=YHRJJTOYJDEJGZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.