* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,5-DIETHYL-2-(FURAN-2-YL)MORPHOLINE |
English Synonyms: | 5,5-DIETHYL-2-(FURAN-2-YL)MORPHOLINE |
MDL Number.: | MFCD16784902 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC1(COC(CN1)c2ccco2)CC |
InChi: | InChI=1S/C12H19NO2/c1-3-12(4-2)9-15-11(8-13-12)10-6-5-7-14-10/h5-7,11,13H,3-4,8-9H2,1-2H3 |
InChiKey: | InChIKey=AXVWDSBIBYPZCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.