* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5,5-DIETHYL-2-(THIOPHEN-2-YL)MORPHOLINE |
| English Synonyms: | 5,5-DIETHYL-2-(THIOPHEN-2-YL)MORPHOLINE |
| MDL Number.: | MFCD16784906 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC1(COC(CN1)c2cccs2)CC |
| InChi: | InChI=1S/C12H19NOS/c1-3-12(4-2)9-14-10(8-13-12)11-6-5-7-15-11/h5-7,10,13H,3-4,8-9H2,1-2H3 |
| InChiKey: | InChIKey=LWOSQMXBKUWBPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.