* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321410 |
English Synonyms: | UKRORGSYN-BB BBV-34321410 |
MDL Number.: | MFCD16784944 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cn(cn1)CCCNC2(CCCC2)CO |
InChi: | InChI=1S/C12H21N3O/c16-10-12(4-1-2-5-12)14-6-3-8-15-9-7-13-11-15/h7,9,11,14,16H,1-6,8,10H2 |
InChiKey: | InChIKey=OMHBYJVNZPVZQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.