* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34321414 |
English Synonyms: | UKRORGSYN-BB BBV-34321414 |
MDL Number.: | MFCD16784948 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1nccn1CCNC2(CCCC2)CO |
InChi: | InChI=1S/C12H21N3O/c1-11-13-6-8-15(11)9-7-14-12(10-16)4-2-3-5-12/h6,8,14,16H,2-5,7,9-10H2,1H3 |
InChiKey: | InChIKey=ABNZVRZXEAESHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.