* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(THIOPHEN-3-YL)-4-OXA-1-AZASPIRO[5.5]UNDECANE |
| English Synonyms: | 3-(THIOPHEN-3-YL)-4-OXA-1-AZASPIRO[5.5]UNDECANE |
| MDL Number.: | MFCD16785548 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cscc1C2CNC3(CCCCC3)CO2 |
| InChi: | InChI=1S/C13H19NOS/c1-2-5-13(6-3-1)10-15-12(8-14-13)11-4-7-16-9-11/h4,7,9,12,14H,1-3,5-6,8,10H2 |
| InChiKey: | InChIKey=SKSWWRNKDNTDCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.