* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,3-DIMETHYL-4-OXA-1-AZASPIRO[5.5]UNDECANE |
| English Synonyms: | 3,3-DIMETHYL-4-OXA-1-AZASPIRO[5.5]UNDECANE |
| MDL Number.: | MFCD16785549 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1(CNC2(CCCCC2)CO1)C |
| InChi: | InChI=1S/C11H21NO/c1-10(2)8-12-11(9-13-10)6-4-3-5-7-11/h12H,3-9H2,1-2H3 |
| InChiKey: | InChIKey=RLPCPQSCBFURAT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.