* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34322028 |
English Synonyms: | UKRORGSYN-BB BBV-34322028 |
MDL Number.: | MFCD16785550 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CCC2(CC1)COC3CCCCC3N2 |
InChi: | InChI=1S/C13H23NO/c1-4-8-13(9-5-1)10-15-12-7-3-2-6-11(12)14-13/h11-12,14H,1-10H2 |
InChiKey: | InChIKey=QMSDQHVRNQERQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.