* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34322041 |
English Synonyms: | UKRORGSYN-BB BBV-34322041 |
MDL Number.: | MFCD16785562 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1nncn1C2(CCCCC2)CO |
InChi: | InChI=1S/C9H15N3O/c13-6-9(4-2-1-3-5-9)12-7-10-11-8-12/h7-8,13H,1-6H2 |
InChiKey: | InChIKey=JENMFTKSADHSFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.