* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34322080 |
English Synonyms: | UKRORGSYN-BB BBV-34322080 |
MDL Number.: | MFCD16785596 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C/C=C/C=C/C(=O)NC1(CCCCC1)CO |
InChi: | InChI=1S/C13H21NO2/c1-2-3-5-8-12(16)14-13(11-15)9-6-4-7-10-13/h2-3,5,8,15H,4,6-7,9-11H2,1H3,(H,14,16)/b3-2+,8-5+ |
InChiKey: | InChIKey=CYKOXHHHLOZEBZ-YNRRLODASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.