* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34322707 |
English Synonyms: | UKRORGSYN-BB BBV-34322707 |
MDL Number.: | MFCD16786185 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cnccc1Cc2nc(on2)CCN |
InChi: | InChI=1S/C10H12N4O/c11-4-1-10-13-9(14-15-10)7-8-2-5-12-6-3-8/h2-3,5-6H,1,4,7,11H2 |
InChiKey: | InChIKey=FHWQXHKRAUOMDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.