* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-37839323 |
English Synonyms: | UKRORGSYN-BB BBV-37839323 |
MDL Number.: | MFCD16786191 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCNCc1nc(no1)Cc2ccncc2 |
InChi: | InChI=1S/C11H14N4O/c1-2-12-8-11-14-10(15-16-11)7-9-3-5-13-6-4-9/h3-6,12H,2,7-8H2,1H3 |
InChiKey: | InChIKey=CXULXQSBWZJUJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.