* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(PYRIDIN-4-YLMETHYL)-1,2,4-OXADIAZOL-5-AMINE |
| English Synonyms: | 3-(PYRIDIN-4-YLMETHYL)-1,2,4-OXADIAZOL-5-AMINE |
| MDL Number.: | MFCD16786338 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cnccc1Cc2nc(on2)N |
| InChi: | InChI=1S/C8H8N4O/c9-8-11-7(12-13-8)5-6-1-3-10-4-2-6/h1-4H,5H2,(H2,9,11,12) |
| InChiKey: | InChIKey=FFGNOBBPCBLUFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.