* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-[3-(PYRIDIN-3-YLMETHYL)-1,2,4-OXADIAZOL-5-YL]PROPAN-1-AMINE |
| English Synonyms: | 3-[3-(PYRIDIN-3-YLMETHYL)-1,2,4-OXADIAZOL-5-YL]PROPAN-1-AMINE |
| MDL Number.: | MFCD16786346 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc(cnc1)Cc2nc(on2)CCCN |
| InChi: | InChI=1S/C11H14N4O/c12-5-1-4-11-14-10(15-16-11)7-9-3-2-6-13-8-9/h2-3,6,8H,1,4-5,7,12H2 |
| InChiKey: | InChIKey=HLXFHXDHUXTVBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.