* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-METHYL-1-(PYRIDIN-4-YL)BUTAN-2-AMINE |
| English Synonyms: | 3-METHYL-1-(PYRIDIN-4-YL)BUTAN-2-AMINE |
| MDL Number.: | MFCD16786413 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)C(Cc1ccncc1)N |
| InChi: | InChI=1S/C10H16N2/c1-8(2)10(11)7-9-3-5-12-6-4-9/h3-6,8,10H,7,11H2,1-2H3 |
| InChiKey: | InChIKey=KQBNVXSDWGSAQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.