* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL[1-(PYRIDIN-4-YL)HEX-4-YN-2-YL]AMINE |
| English Synonyms: | PROPYL[1-(PYRIDIN-4-YL)HEX-4-YN-2-YL]AMINE |
| MDL Number.: | MFCD16786470 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCNC(CC#CC)Cc1ccncc1 |
| InChi: | InChI=1S/C14H20N2/c1-3-5-6-14(16-9-4-2)12-13-7-10-15-11-8-13/h7-8,10-11,14,16H,4,6,9,12H2,1-2H3 |
| InChiKey: | InChIKey=CMWBFJXDCXAZPC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.