* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL[1-(PYRIDIN-4-YL)PENT-4-EN-2-YL]AMINE |
| English Synonyms: | PROPYL[1-(PYRIDIN-4-YL)PENT-4-EN-2-YL]AMINE |
| MDL Number.: | MFCD16786472 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCNC(CC=C)Cc1ccncc1 |
| InChi: | InChI=1S/C13H20N2/c1-3-5-13(15-8-4-2)11-12-6-9-14-10-7-12/h3,6-7,9-10,13,15H,1,4-5,8,11H2,2H3 |
| InChiKey: | InChIKey=WHEGDHQYGISLRM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.