* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(3,4-DIMETHYLPHENYL)-1,1,1-TRIFLUOROPROPAN-2-ONE |
English Synonyms: | 3-(3,4-DIMETHYLPHENYL)-1,1,1-TRIFLUOROPROPAN-2-ONE |
MDL Number.: | MFCD16786650 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1C)CC(=O)C(F)(F)F |
InChi: | InChI=1S/C11H11F3O/c1-7-3-4-9(5-8(7)2)6-10(15)11(12,13)14/h3-5H,6H2,1-2H3 |
InChiKey: | InChIKey=PDQFJTZTWVSTJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.