* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-[(2,5-DIMETHYLPHENYL)METHYL]-4H-1,2,4-TRIAZOL-3-AMINE |
| English Synonyms: | 5-[(2,5-DIMETHYLPHENYL)METHYL]-4H-1,2,4-TRIAZOL-3-AMINE |
| MDL Number.: | MFCD16786696 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(c1)Cc2[nH]c(nn2)N)C |
| InChi: | InChI=1S/C11H14N4/c1-7-3-4-8(2)9(5-7)6-10-13-11(12)15-14-10/h3-5H,6H2,1-2H3,(H3,12,13,14,15) |
| InChiKey: | InChIKey=BUBDUAYIOAFMNG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.