* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(2,5-DIMETHYLPHENYL)-1,1,1-TRIFLUOROPROPAN-2-ONE |
| English Synonyms: | 3-(2,5-DIMETHYLPHENYL)-1,1,1-TRIFLUOROPROPAN-2-ONE |
| MDL Number.: | MFCD16786712 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(c(c1)CC(=O)C(F)(F)F)C |
| InChi: | InChI=1S/C11H11F3O/c1-7-3-4-8(2)9(5-7)6-10(15)11(12,13)14/h3-5H,6H2,1-2H3 |
| InChiKey: | InChIKey=COOGVCOHBRKFPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.