* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(2,5-DIMETHYLPHENYL)HEXAN-2-ONE |
English Synonyms: | 1-(2,5-DIMETHYLPHENYL)HEXAN-2-ONE |
MDL Number.: | MFCD16786723 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CCCCC(=O)Cc1cc(ccc1C)C |
InChi: | InChI=1S/C14H20O/c1-4-5-6-14(15)10-13-9-11(2)7-8-12(13)3/h7-9H,4-6,10H2,1-3H3 |
InChiKey: | InChIKey=SRFYWMSARAKBSX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.