* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(2,5-DIMETHYLPHENYL)-4,4-DIMETHYLPENTAN-2-ONE |
| English Synonyms: | 1-(2,5-DIMETHYLPHENYL)-4,4-DIMETHYLPENTAN-2-ONE |
| MDL Number.: | MFCD16786725 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(c(c1)CC(=O)CC(C)(C)C)C |
| InChi: | InChI=1S/C15H22O/c1-11-6-7-12(2)13(8-11)9-14(16)10-15(3,4)5/h6-8H,9-10H2,1-5H3 |
| InChiKey: | InChIKey=RGCFIMWXYSNGPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.