* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(2,5-DIMETHYLPHENYL)-3-ETHYLPENTAN-2-AMINE |
| English Synonyms: | 1-(2,5-DIMETHYLPHENYL)-3-ETHYLPENTAN-2-AMINE |
| MDL Number.: | MFCD16786730 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCC(CC)C(Cc1cc(ccc1C)C)N |
| InChi: | InChI=1S/C15H25N/c1-5-13(6-2)15(16)10-14-9-11(3)7-8-12(14)4/h7-9,13,15H,5-6,10,16H2,1-4H3 |
| InChiKey: | InChIKey=XELZNVXCFAASOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.