* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-[(2,5-DIMETHYLPHENYL)METHYL]-3-ETHYL-1H-1,2,4-TRIAZOLE |
English Synonyms: | 5-[(2,5-DIMETHYLPHENYL)METHYL]-3-ETHYL-1H-1,2,4-TRIAZOLE |
MDL Number.: | MFCD16786748 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1nc([nH]n1)Cc2cc(ccc2C)C |
InChi: | InChI=1S/C13H17N3/c1-4-12-14-13(16-15-12)8-11-7-9(2)5-6-10(11)3/h5-7H,4,8H2,1-3H3,(H,14,15,16) |
InChiKey: | InChIKey=SHKYUMVOGXXXJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.