* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2,5-DIMETHYLPHENYL)-N-(PROP-2-YN-1-YL)ACETAMIDE |
English Synonyms: | 2-(2,5-DIMETHYLPHENYL)-N-(PROP-2-YN-1-YL)ACETAMIDE |
MDL Number.: | MFCD16786759 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccc(c(c1)CC(=O)NCC#C)C |
InChi: | InChI=1S/C13H15NO/c1-4-7-14-13(15)9-12-8-10(2)5-6-11(12)3/h1,5-6,8H,7,9H2,2-3H3,(H,14,15) |
InChiKey: | InChIKey=CWVFFNQABJUJQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.