* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(1,2-OXAZOL-3-YL)-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-6-AMINE |
| English Synonyms: | 3-(1,2-OXAZOL-3-YL)-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-6-AMINE |
| MDL Number.: | MFCD16786767 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cc2nnc(n2cc1N)c3ccon3 |
| InChi: | InChI=1S/C9H7N5O/c10-6-1-2-8-11-12-9(14(8)5-6)7-3-4-15-13-7/h1-5H,10H2 |
| InChiKey: | InChIKey=BDDRCSQJOZFZCJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.