* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(3-METHYLTHIOPHEN-2-YL)-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-6-AMINE |
English Synonyms: | 3-(3-METHYLTHIOPHEN-2-YL)-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-6-AMINE |
MDL Number.: | MFCD16786774 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccsc1c2nnc3n2cc(cc3)N |
InChi: | InChI=1S/C11H10N4S/c1-7-4-5-16-10(7)11-14-13-9-3-2-8(12)6-15(9)11/h2-6H,12H2,1H3 |
InChiKey: | InChIKey=LBGOWNWTWJNIGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.