* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHOXY-3,4-DIFLUOROANILINE |
English Synonyms: | 2-ETHOXY-3,4-DIFLUOROANILINE |
MDL Number.: | MFCD16787317 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCOc1c(ccc(c1F)F)N |
InChi: | InChI=1S/C8H9F2NO/c1-2-12-8-6(11)4-3-5(9)7(8)10/h3-4H,2,11H2,1H3 |
InChiKey: | InChIKey=NUOCJEKHYYUWSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.