* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-DIFLUORO-2-(HEXYLOXY)ANILINE |
English Synonyms: | 3,4-DIFLUORO-2-(HEXYLOXY)ANILINE |
MDL Number.: | MFCD16787331 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCCOc1c(ccc(c1F)F)N |
InChi: | InChI=1S/C12H17F2NO/c1-2-3-4-5-8-16-12-10(15)7-6-9(13)11(12)14/h6-7H,2-5,8,15H2,1H3 |
InChiKey: | InChIKey=OQBBCJBVYKZKTH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.