* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-(6-AMINO-2,3-DIFLUOROPHENOXY)PROPAN-1-OL |
| English Synonyms: | 3-(6-AMINO-2,3-DIFLUOROPHENOXY)PROPAN-1-OL |
| MDL Number.: | MFCD16787334 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(c(c(c1N)OCCCO)F)F |
| InChi: | InChI=1S/C9H11F2NO2/c10-6-2-3-7(12)9(8(6)11)14-5-1-4-13/h2-3,13H,1,4-5,12H2 |
| InChiKey: | InChIKey=KUDSLDCMHCURSC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.