* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34324029 |
English Synonyms: | UKRORGSYN-BB BBV-34324029 |
MDL Number.: | MFCD16787347 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1ccnc1Sc2c(ccc(c2F)F)N |
InChi: | InChI=1S/C10H9F2N3S/c1-15-5-4-14-10(15)16-9-7(13)3-2-6(11)8(9)12/h2-5H,13H2,1H3 |
InChiKey: | InChIKey=CZPJRONUBJBBME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.