* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N-(1-METHOXYPROPAN-2-YL)-1H-INDAZOL-6-AMINE |
| English Synonyms: | N-(1-METHOXYPROPAN-2-YL)-1H-INDAZOL-6-AMINE |
| MDL Number.: | MFCD16787789 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(COC)Nc1ccc2cn[nH]c2c1 |
| InChi: | InChI=1S/C11H15N3O/c1-8(7-15-2)13-10-4-3-9-6-12-14-11(9)5-10/h3-6,8,13H,7H2,1-2H3,(H,12,14) |
| InChiKey: | InChIKey=GUUONDYMDVGTID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.