* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-BROMO-1-METHOXYPROPANE |
| CAS: | 22461-48-9 |
| English Synonyms: | 2-BROMO-1-METHOXYPROPANE |
| MDL Number.: | MFCD16788465 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(COC)Br |
| InChi: | InChI=1S/C4H9BrO/c1-4(5)3-6-2/h4H,3H2,1-2H3 |
| InChiKey: | InChIKey=PBHYCZIZMTYKAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.