* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4,5-DIMETHYL-1H-IMIDAZOL-1-YL)PROPAN-1-AMINE |
English Synonyms: | 2-(4,5-DIMETHYL-1H-IMIDAZOL-1-YL)PROPAN-1-AMINE |
MDL Number.: | MFCD16789573 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1c(n(cn1)C(C)CN)C |
InChi: | InChI=1S/C8H15N3/c1-6(4-9)11-5-10-7(2)8(11)3/h5-6H,4,9H2,1-3H3 |
InChiKey: | InChIKey=VCUVOTSRJMTGCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.