* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-ETHYL-1,3-THIAZOL-2-YL)PIPERIDINE |
English Synonyms: | 2-(4-ETHYL-1,3-THIAZOL-2-YL)PIPERIDINE |
MDL Number.: | MFCD16789586 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCc1csc(n1)C2CCCCN2 |
InChi: | InChI=1S/C10H16N2S/c1-2-8-7-13-10(12-8)9-5-3-4-6-11-9/h7,9,11H,2-6H2,1H3 |
InChiKey: | InChIKey=GPCFLEWCYTZPPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.